Terminology Service for NFDI4Health
All terms in CHEBI
| Label | Id | Description |
|---|---|---|
| DG(24:1(15Z)/14:0/0:0) | CHEBI_89630 | |
| diglyceride | CHEBI_18035 | [A glyceride that is glycerol in which any two of the hydroxy groups have been acylated. In the structure shown, two of the R groups (positions not specified) are acyl groups while the remaining R group can be either H or an alkyl group.] |
| DG(24:1(15Z)/14:1(9Z)/0:0) | CHEBI_89631 | |
| Methyl (methylthio)methyl disulfide | CHEBI_89632 | |
| Metanephrine | CHEBI_89633 | |
| Melanin | CHEBI_89634 | |
| melanins | CHEBI_25179 | |
| Ganglioside GM2 (d18:1/26:0) | CHEBI_89635 | |
| Ins-1-P-6-Man-1-2-Ins-1-P-Cer B/B'(2-) | CHEBI_75000 | [An Ins-1-P-6-Man-1-2-Ins-1-P-Cer(2-) in which either the acyl group is hydroxylated at position 2 or the ceramide base is hydroxylated at position 4.] |
| Ins-1-P-6-Man-1-2-Ins-1-P-Cer(2-) | CHEBI_74997 | [A class of anionic phospholipids consisting of ceramide derivatives containing a common inositol-P-mannose-inositol-P head group.] |
| Ins-1-P-6-Man-1-2-Ins-1-P-Cer B/B' 42:0(2-) | CHEBI_75001 | [An Ins-1-P-6-Man-1-2-Ins-1-P-Cer B/B'(2-) in which the acyl group and the ceramide base contain a total of 42 carbons and 0 double bonds, with either the acyl group hydroxylated at position 2 or the ceramide base hydroxylated at position 4.] |
| Ins-1-P-6-Man-1-2-Ins-1-P-Cer B/B' 44:0(2-) | CHEBI_75002 | [An Ins-1-P-6-Man-1-2-Ins-1-P-Cer B/B'(2-) in which the acyl group and the ceramide base contain a total of 44 carbons and 0 double bonds, with either the acyl group hydroxylated at position 2 or the ceramide base hydroxylated at position 4.] |
| Tyr-Leu | CHEBI_75003 | [A dipeptide formed from L-tyrosine and L-leucine residues.] |
| Tyr-Lys | CHEBI_75004 | [A dipeptide formed from L-tyrosine and L-lysine residues.] |
| Tyr-Phe | CHEBI_75005 | [A dipeptide formed from L-tyrosine and L-phenylalanine residues.] |
| DG(20:4(8Z,11Z,14Z,17Z)/20:3(8Z,11Z,14Z)/0:0) | CHEBI_89647 | |
| PC(16:1(9Z)/P-18:1(11Z)) | CHEBI_89648 | |
| glycerophosphocholine | CHEBI_36313 | [The glycerol phosphate ester of a phosphocholine. A nutrient with many different roles in human health.] |
| 5-hydroxyindole | CHEBI_89649 | [A member of the class of hydroxyindoles that is 1H-indole in which the hydrogen at position 5 has been replaced by a hydroxy group.] |
| Nicotinamide N-oxide | CHEBI_89640 |